Structure of PDB 5d7q Chain B Binding Site BS03 |
|
|
Ligand ID | 4I5 |
InChI | InChI=1S/C14H15ClN2O/c15-8-5-6-12-11(7-8)9-3-1-2-4-10(14(16)18)13(9)17-12/h5-7,10,17H,1-4H2,(H2,16,18)/t10-/m0/s1 |
InChIKey | ABIVOOWWGYJNLV-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC(=O)[C@H]1CCCCc2c1[nH]c3ccc(Cl)cc23 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1Cl)c3c([nH]2)C(CCCC3)C(=O)N | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1Cl)c3c([nH]2)[C@H](CCCC3)C(=O)N | CACTVS 3.370 | NC(=O)[CH]1CCCCc2c1[nH]c3ccc(Cl)cc23 | ACDLabs 12.01 | Clc2cc1c3c(nc1cc2)C(C(=O)N)CCCC3 |
|
Formula | C14 H15 Cl N2 O |
Name | (6S)-2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxamide |
ChEMBL | CHEMBL198609 |
DrugBank | |
ZINC | ZINC000000499303
|
PDB chain | 5d7q Chain B Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|