Structure of PDB 5cks Chain B Binding Site BS03 |
|
|
Ligand ID | 52L |
InChI | InChI=1S/C7H14NO10P/c9-4(1-3(8-14)7(12)13)6(11)5(10)2-18-19(15,16)17/h4-6,9-11,14H,1-2H2,(H,12,13)(H2,15,16,17)/b8-3+/t4-,5-,6+/m1/s1 |
InChIKey | KFGHSGKOOHKNEU-WVMCLEPLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C(C(C(C(COP(=O)(O)O)O)O)O)C(=NO)C(=O)O | CACTVS 3.385 | ON=C(C[CH](O)[CH](O)[CH](O)CO[P](O)(O)=O)C(O)=O | ACDLabs 12.01 | N(/O)=C(\C(O)=O)CC(C(O)C(COP(O)(O)=O)O)O | CACTVS 3.385 | O/N=C(C[C@@H](O)[C@H](O)[C@H](O)CO[P](O)(O)=O)/C(O)=O | OpenEye OEToolkits 1.9.2 | C([C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)/C(=N\O)/C(=O)O |
|
Formula | C7 H14 N O10 P |
Name | DAHP Oxime; (2E,4R,5S,6R)-4,5,6-trihydroxy-2-(hydroxyimino)-7-(phosphonooxy)heptanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905133
|
PDB chain | 5cks Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.54: 3-deoxy-7-phosphoheptulonate synthase. |
|
|
|