Structure of PDB 4q3r Chain B Binding Site BS03 |
|
|
Ligand ID | XA2 |
InChI | InChI=1S/C18H28BCl2N2O5/c20-15-4-3-13(11-16(15)21)12-23-9-5-14(6-10-23)18(22,17(24)25)7-1-2-8-19(26,27)28/h3-4,11,14,26-28H,1-2,5-10,12,22H2,(H,24,25)/q-1/t18-/m1/s1 |
InChIKey | LYUGMNLZENMUTE-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[C](CCCC[B-](O)(O)O)(C1CCN(CC1)Cc2ccc(Cl)c(Cl)c2)C(O)=O | OpenEye OEToolkits 1.7.6 | [B-](CCCC[C@@](C1CCN(CC1)Cc2ccc(c(c2)Cl)Cl)(C(=O)O)N)(O)(O)O | ACDLabs 12.01 | O=C(O)C(N)(C2CCN(Cc1cc(Cl)c(Cl)cc1)CC2)CCCC[B-](O)(O)O | OpenEye OEToolkits 1.7.6 | [B-](CCCCC(C1CCN(CC1)Cc2ccc(c(c2)Cl)Cl)(C(=O)O)N)(O)(O)O | CACTVS 3.385 | N[C@](CCCC[B-](O)(O)O)(C1CCN(CC1)Cc2ccc(Cl)c(Cl)c2)C(O)=O |
|
Formula | C18 H28 B Cl2 N2 O5 |
Name | (R)-2-amino-6-borono-2-(1-(3,4-dichlorobenzyl)piperidin-4-yl)hexanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000207869614
|
PDB chain | 4q3r Chain B Residue 409
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|