Structure of PDB 4okz Chain B Binding Site BS03 |
|
|
Ligand ID | 3E9 |
InChI | InChI=1S/C15H30O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,15H,5-6,8,10-12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+/t15-/m0/s1 |
InChIKey | UGQVBUXMCRXOIF-HNRFISLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(CCC=C(C)CCC=C(C)C)CCOP(=O)(O)OP(=O)(O)O | OpenEye OEToolkits 1.7.6 | C[C@@H](CC/C=C(\C)/CCC=C(C)C)CCOP(=O)(O)OP(=O)(O)O | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OCCC(C)CC\C=C(/C)CC\C=C(/C)C)O | CACTVS 3.385 | C[C@H](CCO[P](O)(=O)O[P](O)(O)=O)CC\C=C(/C)CCC=C(C)C | CACTVS 3.385 | C[CH](CCO[P](O)(=O)O[P](O)(O)=O)CCC=C(C)CCC=C(C)C |
|
Formula | C15 H30 O7 P2 |
Name | (3S,6E)-3,7,11-trimethyldodeca-6,10-dien-1-yl trihydrogen diphosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008216158
|
PDB chain | 4okz Chain B Residue 904
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|