Structure of PDB 4o9e Chain B Binding Site BS03 |
|
|
Ligand ID | 4TD |
InChI | InChI=1S/C17H36O8/c1-13(18)5-22-9-17(10-23-6-14(2)19,11-24-7-15(3)20)12-25-8-16(4)21/h13-16,18-21H,5-12H2,1-4H3/t13-,14-,15-,16+/m0/s1 |
InChIKey | GXEZGLLPFFKHGE-YHUYYLMFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(COCC(COCC(C)O)(COCC(C)O)COCC(C)O)O | OpenEye OEToolkits 1.7.6 | C[C@H](COCC(COC[C@H](C)O)(COC[C@H](C)O)COC[C@H](C)O)O | CACTVS 3.385 | C[C@H](O)COC[C@](COC[C@H](C)O)(COC[C@H](C)O)COC[C@@H](C)O | ACDLabs 12.01 | O(CC(O)C)CC(COCC(O)C)(COCC(O)C)COCC(O)C | CACTVS 3.385 | C[CH](O)COC[C](COC[CH](C)O)(COC[CH](C)O)COC[CH](C)O |
|
Formula | C17 H36 O8 |
Name | (2S)-1-[3-[(2S)-2-oxidanylpropoxy]-2-[[(2S)-2-oxidanylpropoxy]methyl]-2-[[(2R)-2-oxidanylpropoxy]methyl]propoxy]propan-2-ol; tetraerythritol propoxylate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4o9e Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|