Structure of PDB 4dxj Chain B Binding Site BS03 |
|
|
Ligand ID | 0M9 |
InChI | InChI=1S/C5H15NO6P2/c1-2-3-6-4-5(13(7,8)9)14(10,11)12/h5-6H,2-4H2,1H3,(H2,7,8,9)(H2,10,11,12) |
InChIKey | YFFJUBPLIKXHAO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=P(O)(O)C(CNCCC)P(=O)(O)O | CACTVS 3.370 | CCCNCC([P](O)(O)=O)[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | CCCNCC(P(=O)(O)O)P(=O)(O)O |
|
Formula | C5 H15 N O6 P2 |
Name | [2-(propylamino)ethane-1,1-diyl]bis(phosphonic acid) |
ChEMBL | CHEMBL408745 |
DrugBank | |
ZINC | ZINC000029061589
|
PDB chain | 4dxj Chain B Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|