Structure of PDB 4aoc Chain B Binding Site BS03 |
|
|
Ligand ID | A1Q |
InChI | InChI=1S/C8H16O7/c1-14-8-6(13)4(11)5(12)7(15-8)3(10)2-9/h3-13H,2H2,1H3/t3-,4-,5-,6-,7+,8-/m0/s1 |
InChIKey | GJUAFBSAJCBGRU-IHKZFYOVSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC1C(O)C(O)C(OC1OC)C(O)CO | CACTVS 3.385 | CO[CH]1O[CH]([CH](O)CO)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.9.2 | CO[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)[C@H](CO)O)O)O)O | OpenEye OEToolkits 1.9.2 | COC1C(C(C(C(O1)C(CO)O)O)O)O | CACTVS 3.385 | CO[C@H]1O[C@H]([C@@H](O)CO)[C@@H](O)[C@H](O)[C@@H]1O |
|
Formula | C8 H16 O7 |
Name | methyl L-glycero-alpha-D-manno-heptopyranoside; ALPHA-METHYL HEPTOPYRANOSE; methyl L-glycero-alpha-D-manno-heptoside; methyl L-glycero-D-manno-heptoside; methyl L-glycero-manno-heptoside |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208622
|
PDB chain | 4aoc Chain B Residue 1131
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|