Structure of PDB 3ras Chain B Binding Site BS03 |
|
|
Ligand ID | DCV |
InChI | InChI=1S/C11H14Cl2NO5P/c1-7(15)14(16)5-4-11(20(17,18)19)8-2-3-9(12)10(13)6-8/h2-3,6,11,16H,4-5H2,1H3,(H2,17,18,19)/t11-/m1/s1 |
InChIKey | ABGCTQYLJZGMBM-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(=O)N(CCC(c1ccc(c(c1)Cl)Cl)P(=O)(O)O)O | OpenEye OEToolkits 1.7.0 | CC(=O)N(CC[C@H](c1ccc(c(c1)Cl)Cl)P(=O)(O)O)O | ACDLabs 12.01 | Clc1ccc(cc1Cl)C(CCN(O)C(=O)C)P(=O)(O)O | CACTVS 3.370 | CC(=O)N(O)CC[CH](c1ccc(Cl)c(Cl)c1)[P](O)(O)=O | CACTVS 3.370 | CC(=O)N(O)CC[C@H](c1ccc(Cl)c(Cl)c1)[P](O)(O)=O |
|
Formula | C11 H14 Cl2 N O5 P |
Name | [(1R)-3-[acetyl(hydroxy)amino]-1-(3,4-dichlorophenyl)propyl]phosphonic acid |
ChEMBL | CHEMBL1651836 |
DrugBank | |
ZINC | ZINC000028572274
|
PDB chain | 3ras Chain B Residue 391
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
Biological Process |
GO:0008299 |
isoprenoid biosynthetic process |
GO:0019288 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway |
GO:0051483 |
terpenoid biosynthetic process, mevalonate-independent |
GO:0051484 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway involved in terpenoid biosynthetic process |
|
|