Structure of PDB 3h6v Chain B Binding Site BS03 |
|
|
Ligand ID | NS6 |
InChI | InChI=1S/C18H27N3O4S2/c1-20-8-10-21(11-9-20)27(24,25)16-7-6-15-12-17(14-4-2-3-5-14)19-26(22,23)18(15)13-16/h6-7,13-14,17,19H,2-5,8-12H2,1H3/t17-/m1/s1 |
InChIKey | QZBQVXXESPXFPZ-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CN1CCN(CC1)S(=O)(=O)c2ccc3c(c2)S(=O)(=O)NC(C3)C4CCCC4 | CACTVS 3.341 | CN1CCN(CC1)[S](=O)(=O)c2ccc3C[C@@H](N[S](=O)(=O)c3c2)C4CCCC4 | OpenEye OEToolkits 1.5.0 | CN1CCN(CC1)S(=O)(=O)c2ccc3c(c2)S(=O)(=O)N[C@H](C3)C4CCCC4 | ACDLabs 10.04 | O=S(=O)(c1ccc2c(c1)S(=O)(=O)NC(C2)C3CCCC3)N4CCN(C)CC4 | CACTVS 3.341 | CN1CCN(CC1)[S](=O)(=O)c2ccc3C[CH](N[S](=O)(=O)c3c2)C4CCCC4 |
|
Formula | C18 H27 N3 O4 S2 |
Name | (3R)-3-cyclopentyl-7-[(4-methylpiperazin-1-yl)sulfonyl]-3,4-dihydro-2H-1,2-benzothiazine 1,1-dioxide |
ChEMBL | |
DrugBank | DB08304 |
ZINC | ZINC000038397218
|
PDB chain | 3h6v Chain B Residue 265
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|