Structure of PDB 3h6k Chain B Binding Site BS03 |
|
|
Ligand ID | 33T |
InChI | InChI=1S/C19H18ClF4N3O3S/c1-11-10-26(16-4-3-13(21)9-14(16)19(22,23)24)6-7-27(11)31(29,30)17-5-2-12(18(25)28)8-15(17)20/h2-5,8-9,11H,6-7,10H2,1H3,(H2,25,28)/t11-/m1/s1 |
InChIKey | OMWNFYWEMXUREB-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1CN(CCN1S(=O)(=O)c2ccc(cc2Cl)C(=O)N)c3ccc(cc3C(F)(F)F)F | OpenEye OEToolkits 1.5.0 | C[C@@H]1C[N@](CC[N@@]1S(=O)(=O)c2ccc(cc2Cl)C(=O)N)c3ccc(cc3C(F)(F)F)F | CACTVS 3.341 | C[C@@H]1CN(CCN1[S](=O)(=O)c2ccc(cc2Cl)C(N)=O)c3ccc(F)cc3C(F)(F)F | ACDLabs 10.04 | O=C(N)c1ccc(c(Cl)c1)S(=O)(=O)N3C(CN(c2c(cc(F)cc2)C(F)(F)F)CC3)C | CACTVS 3.341 | C[CH]1CN(CCN1[S](=O)(=O)c2ccc(cc2Cl)C(N)=O)c3ccc(F)cc3C(F)(F)F |
|
Formula | C19 H18 Cl F4 N3 O3 S |
Name | 3-chloro-4-({(2R)-4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methylpiperazin-1-yl}sulfonyl)benzamide |
ChEMBL | CHEMBL550175 |
DrugBank | |
ZINC | ZINC000043013338
|
PDB chain | 3h6k Chain B Residue 293
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S170 Y183 K187 |
Catalytic site (residue number reindexed from 1) |
S149 Y162 K166 |
Enzyme Commision number |
1.1.1.146: 11beta-hydroxysteroid dehydrogenase. 1.1.1.201: 7beta-hydroxysteroid dehydrogenase (NADP(+)). |
|
|
|