Structure of PDB 3g15 Chain B Binding Site BS03 |
|
|
Ligand ID | HC6 |
InChI | InChI=1S/C24H34N2O4/c1-25(2)13-15-29-23(27,17-25)21-9-5-19(6-10-21)20-7-11-22(12-8-20)24(28)18-26(3,4)14-16-30-24/h5-12,27-28H,13-18H2,1-4H3/q+2/t23-,24-/m1/s1 |
InChIKey | JIWUESGGKYLPPG-DNQXCXABSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[N+]1(CCO[C@](C1)(c2ccc(cc2)c3ccc(cc3)[C@]4(C[N+](CCO4)(C)C)O)O)C | CACTVS 3.341 | C[N+]1(C)CCO[C](O)(C1)c2ccc(cc2)c3ccc(cc3)[C]4(O)C[N+](C)(C)CCO4 | CACTVS 3.341 | C[N+]1(C)CCO[C@](O)(C1)c2ccc(cc2)c3ccc(cc3)[C@@]4(O)C[N+](C)(C)CCO4 | OpenEye OEToolkits 1.5.0 | C[N+]1(CCOC(C1)(c2ccc(cc2)c3ccc(cc3)C4(C[N+](CCO4)(C)C)O)O)C | ACDLabs 10.04 | OC1(OCC[N+](C)(C)C1)c2ccc(cc2)c3ccc(cc3)C4(O)OCC[N+](C)(C)C4 |
|
Formula | C24 H34 N2 O4 |
Name | (2S,2'S)-2,2'-biphenyl-4,4'-diylbis(2-hydroxy-4,4-dimethylmorpholin-4-ium) |
ChEMBL | CHEMBL1229238 |
DrugBank | |
ZINC | ZINC000001606984
|
PDB chain | 3g15 Chain B Residue 603
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|