Structure of PDB 3e12 Chain B Binding Site BS03 |
|
|
Ligand ID | KD0 |
InChI | InChI=1S/C8H15O11P/c9-3(1-4(10)8(14)15)6(12)7(13)5(11)2-19-20(16,17)18/h3,5-7,9,11-13H,1-2H2,(H,14,15)(H2,16,17,18)/t3-,5-,6-,7-/m1/s1 |
InChIKey | RTNBXJBOAIDPME-SHUUEZRQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C(C(C(C(C(COP(=O)(O)O)O)O)O)O)C(=O)C(=O)O | CACTVS 3.341 | O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@H](O)[C@H](O)CC(=O)C(O)=O | ACDLabs 10.04 | O=P(O)(O)OCC(O)C(O)C(O)C(O)CC(=O)C(=O)O | OpenEye OEToolkits 1.5.0 | C([C@H]([C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)O)C(=O)C(=O)O | CACTVS 3.341 | O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)[CH](O)CC(=O)C(O)=O |
|
Formula | C8 H15 O11 P |
Name | 3-deoxy-8-O-phosphono-D-manno-oct-2-ulosonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003870009
|
PDB chain | 3e12 Chain B Residue 268
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.55: 3-deoxy-8-phosphooctulonate synthase. |
|
|
|