Structure of PDB 3cwd Chain B Binding Site BS03 |
|
|
Ligand ID | LNB |
InChI | InChI=1S/C18H31NO4/c1-2-3-4-11-14-17(19(22)23)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,14H,2-8,10-11,13,15-16H2,1H3,(H,20,21)/b12-9-,17-14+ |
InChIKey | ZYFTUIURWQWFKQ-QIAGQCQHSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C(O)CCCCCCC/C=C\CC(=C/CCCCC)\[N+]([O-])=O | OpenEye OEToolkits 1.5.0 | CCCCCC=C(CC=CCCCCCCCC(=O)O)[N+](=O)[O-] | OpenEye OEToolkits 1.5.0 | CCCCC\C=C(/C\C=C/CCCCCCCC(=O)O)\[N+](=O)[O-] | CACTVS 3.341 | CCCCC\C=C(/C\C=C/CCCCCCCC(O)=O)[N+]([O-])=O | CACTVS 3.341 | CCCCCC=C(CC=CCCCCCCCC(O)=O)[N+]([O-])=O |
|
Formula | C18 H31 N O4 |
Name | (9Z,12E)-12-nitrooctadeca-9,12-dienoic acid |
ChEMBL | CHEMBL554608 |
DrugBank | |
ZINC |
|
PDB chain | 3cwd Chain B Residue 478
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|