Structure of PDB 3c27 Chain B Binding Site BS03 |
|
|
Ligand ID | DKK |
InChI | InChI=1S/C19H20F3N7O2/c20-17-13(9-16(30)27-7-8-31-29-18(24)25)12(10-23)4-5-14(17)28-11-19(21,22)15-3-1-2-6-26-15/h1-6,28H,7-9,11H2,(H,27,30)(H4,24,25,29) |
InChIKey | STHCHQXQLDMISY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | NC(=N)NOCCNC(=O)Cc1c(F)c(NCC(F)(F)c2ccccn2)ccc1C#N | ACDLabs 10.04 | FC(F)(c1ncccc1)CNc2ccc(C#N)c(c2F)CC(=O)NCCONC(=[N@H])N | OpenEye OEToolkits 1.5.0 | [H]N=C(N)NOCCNC(=O)Cc1c(ccc(c1F)NCC(c2ccccn2)(F)F)C#N | OpenEye OEToolkits 1.5.0 | [H]/N=C(\N)/NOCCNC(=O)Cc1c(ccc(c1F)NCC(c2ccccn2)(F)F)C#N |
|
Formula | C19 H20 F3 N7 O2 |
Name | N-[2-(carbamimidamidooxy)ethyl]-2-{6-cyano-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-fluorophenyl}acetamide |
ChEMBL | CHEMBL257543 |
DrugBank | DB07665 |
ZINC | ZINC000029042456
|
PDB chain | 3c27 Chain B Residue 5000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|