Structure of PDB 3aqc Chain B Binding Site BS03 |
|
|
Ligand ID | 2DE |
InChI | InChI=1S/C14H26O7P2/c1-13(2)9-8-11-14(3)10-6-4-5-7-12-20-23(18,19)21-22(15,16)17/h5,7,9-10H,4,6,8,11-12H2,1-3H3,(H,18,19)(H2,15,16,17)/b7-5+,14-10+ |
InChIKey | AFSHNJXUHHFZPQ-XOBXVUKQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(C)=CCC/C(C)=C/CC/C=C/CO[P](O)(=O)O[P](O)(O)=O | OpenEye OEToolkits 1.7.0 | CC(=CCC/C(=C/CC/C=C/CO[P@](=O)(O)OP(=O)(O)O)/C)C | CACTVS 3.370 | CC(C)=CCCC(C)=CCCC=CCO[P](O)(=O)O[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OC/C=C/CC\C=C(/C)CC\C=C(/C)C)O | OpenEye OEToolkits 1.7.0 | CC(=CCCC(=CCCC=CCOP(=O)(O)OP(=O)(O)O)C)C |
|
Formula | C14 H26 O7 P2 |
Name | (2E,6E)-7,11-dimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate |
ChEMBL | CHEMBL1229905 |
DrugBank | |
ZINC | ZINC000013542325
|
PDB chain | 3aqc Chain B Residue 329
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.83: hexaprenyl-diphosphate synthase [(2E,6E)-farnesyl-diphosphate specific]. |
|
|
|