Structure of PDB 2r2m Chain B Binding Site BS03 |
|
|
Ligand ID | I50 |
InChI | InChI=1S/C19H21ClF3N5O2/c20-14-6-7-15(27-11-19(22,23)12-4-2-1-3-5-12)17(21)13(14)10-16(29)26-8-9-30-28-18(24)25/h1-7,27H,8-11H2,(H,26,29)(H4,24,25,28) |
InChIKey | DZEJHPMTDNDECN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | [H]/N=C(/N)\NOCCNC(=O)Cc1c(ccc(c1F)NCC(c2ccccc2)(F)F)Cl | OpenEye OEToolkits 1.5.0 | [H]N=C(N)NOCCNC(=O)Cc1c(ccc(c1F)NCC(c2ccccc2)(F)F)Cl | CACTVS 3.341 | NC(=N)NOCCNC(=O)Cc1c(F)c(NCC(F)(F)c2ccccc2)ccc1Cl | ACDLabs 10.04 | Clc1ccc(c(F)c1CC(=O)NCCONC(=[N@H])N)NCC(F)(F)c2ccccc2 |
|
Formula | C19 H21 Cl F3 N5 O2 |
Name | N-[2-({[amino(imino)methyl]amino}oxy)ethyl]-2-{6-chloro-3-[(2,2-difluoro-2-phenylethyl)amino]-2-fluorophenyl}acetamide |
ChEMBL | CHEMBL401842 |
DrugBank | DB07946 |
ZINC | ZINC000034241908
|
PDB chain | 2r2m Chain B Residue 5000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|