Structure of PDB 1x8j Chain B Binding Site BS03 |
|
|
Ligand ID | AOI |
InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13+,14-,15-,16-,18-,19-/m0/s1 |
InChIKey | QGXBDMJGAMFCBF-HLUDHZFRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O | OpenEye OEToolkits 1.7.6 | CC12CCC(CC1CCC3C2CCC4(C3CCC4=O)C)O | CACTVS 3.385 | C[C@]12CC[C@@H](O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@@]4(C)[C@H]3CCC4=O | ACDLabs 12.01 | O=C2C1(CCC3C(C1CC2)CCC4C3(CCC(O)C4)C)C | CACTVS 3.385 | C[C]12CC[CH](O)C[CH]1CC[CH]3[CH]2CC[C]4(C)[CH]3CCC4=O |
|
Formula | C19 H30 O2 |
Name | Androsterone; (3alpha,5beta,8alpha,10alpha,13alpha,14beta)-3-hydroxyandrostan-17-one |
ChEMBL | CHEMBL87285 |
DrugBank | |
ZINC | ZINC000003861550
|
PDB chain | 1x8j Chain B Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
R73 H164 S193 |
Catalytic site (residue number reindexed from 1) |
R67 H158 S187 |
Enzyme Commision number |
? |
|
|
|