Structure of PDB 1efa Chain B Binding Site BS03 |
|
|
Ligand ID | NPF |
InChI | InChI=1S/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-5-3-2-4-7(8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11-,12+/m1/s1 |
InChIKey | SWRPIVXPHLYETN-BVWHHUJWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C[CH]1O[CH](Oc2ccccc2[N+]([O-])=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)Oc2ccccc2[N+](=O)[O-])O)O)O | CACTVS 3.341 | C[C@H]1O[C@@H](Oc2ccccc2[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O | OpenEye OEToolkits 1.5.0 | CC1C(C(C(C(O1)Oc2ccccc2[N+](=O)[O-])O)O)O | ACDLabs 10.04 | [O-][N+](=O)c2c(OC1OC(C(O)C(O)C1O)C)cccc2 |
|
Formula | C12 H15 N O7 |
Name | 2-nitrophenyl beta-D-fucopyranoside; ORTHONITROPHENYL-BETA-D-FUCOPYRANOSIDE; 2-nitrophenyl 6-deoxy-beta-D-galactopyranoside; 2-nitrophenyl beta-D-fucoside; 2-nitrophenyl D-fucoside; 2-nitrophenyl fucoside |
ChEMBL | |
DrugBank | DB08297 |
ZINC | ZINC000006031723
|
PDB chain | 1efa Chain B Residue 902
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|