Structure of PDB 8p92 Chain A Binding Site BS03 |
|
|
Ligand ID | XB0 |
InChI | InChI=1S/C20H21NO3/c1-12(2)15-10-7-11-16-17(15)21-18(20(22)23)19(16)24-13(3)14-8-5-4-6-9-14/h4-13,21H,1-3H3,(H,22,23)/t13-/m0/s1 |
InChIKey | RUGCETAGWUDNRQ-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C[C@@H](c1ccccc1)Oc2c3cccc(c3[nH]c2C(=O)O)C(C)C | OpenEye OEToolkits 2.0.7 | CC(C)c1cccc2c1[nH]c(c2OC(C)c3ccccc3)C(=O)O | CACTVS 3.385 | CC(C)c1cccc2c1[nH]c(C(O)=O)c2O[C@@H](C)c3ccccc3 | CACTVS 3.385 | CC(C)c1cccc2c1[nH]c(C(O)=O)c2O[CH](C)c3ccccc3 |
|
Formula | C20 H21 N O3 |
Name | 3-[(1~{S})-1-phenylethoxy]-7-propan-2-yl-1~{H}-indole-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8p92 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|