Structure of PDB 7tlj Chain A Binding Site BS03 |
|
|
Ligand ID | PQU |
InChI | InChI=1S/C21H17N3O4/c1-21(15-12-13-18(22-14-15)27-17-10-6-3-7-11-17)19(25)24(20(26)28-21)23-16-8-4-2-5-9-16/h2-14,23H,1H3/t21-/m0/s1 |
InChIKey | QOFLFGUNPBNKDO-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | CC1(OC(=O)N(Nc2ccccc2)C1=O)c1cnc(Oc2ccccc2)cc1 | OpenEye OEToolkits 2.0.7 | CC1(C(=O)N(C(=O)O1)Nc2ccccc2)c3ccc(nc3)Oc4ccccc4 | CACTVS 3.385 | C[C]1(OC(=O)N(Nc2ccccc2)C1=O)c3ccc(Oc4ccccc4)nc3 | OpenEye OEToolkits 2.0.7 | C[C@@]1(C(=O)N(C(=O)O1)Nc2ccccc2)c3ccc(nc3)Oc4ccccc4 | CACTVS 3.385 | C[C@]1(OC(=O)N(Nc2ccccc2)C1=O)c3ccc(Oc4ccccc4)nc3 |
|
Formula | C21 H17 N3 O4 |
Name | (5S)-3-anilino-5-methyl-5-(6-phenoxypyridin-3-yl)-1,3-oxazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7tlj Chain A Residue 1003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|