Structure of PDB 7t9h Chain A Binding Site BS03 |
|
|
Ligand ID | GE7 |
InChI | InChI=1S/C23H25NO3/c1-14-10-12-16(13-11-14)20-17-8-6-7-9-18(17)24-15(2)19(20)21(22(25)26)27-23(3,4)5/h6-13,21H,1-5H3,(H,25,26)/t21-/m0/s1 |
InChIKey | ORZNQMRZCHOXIM-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(cc1)c2c3ccccc3nc(C)c2[CH](OC(C)(C)C)C(O)=O | OpenEye OEToolkits 2.0.7 | Cc1ccc(cc1)c2c3ccccc3nc(c2[C@@H](C(=O)O)OC(C)(C)C)C | ACDLabs 12.01 | O=C(O)C(OC(C)(C)C)c1c(c2ccccc2nc1C)c1ccc(C)cc1 | OpenEye OEToolkits 2.0.7 | Cc1ccc(cc1)c2c3ccccc3nc(c2C(C(=O)O)OC(C)(C)C)C | CACTVS 3.385 | Cc1ccc(cc1)c2c3ccccc3nc(C)c2[C@H](OC(C)(C)C)C(O)=O |
|
Formula | C23 H25 N O3 |
Name | (2S)-tert-butoxy[2-methyl-4-(4-methylphenyl)quinolin-3-yl]acetic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7t9h Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|