Structure of PDB 7okj Chain A Binding Site BS03 |
|
|
Ligand ID | VHZ |
InChI | InChI=1S/C19H17ClN6O2/c1-10(19(28)22-2)24-16-8-17(27)26-14-4-3-11(7-12(14)16)25-15-5-6-23-18(20)13(15)9-21/h3-8,10H,1-2H3,(H,22,28)(H,23,25)(H2,24,26,27)/t10-/m1/s1 |
InChIKey | CWFHDWACYRWCLF-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C(=O)NC)NC1=CC(=O)Nc2c1cc(cc2)Nc3ccnc(c3C#N)Cl | CACTVS 3.385 | CNC(=O)[C@@H](C)NC1=CC(=O)Nc2ccc(Nc3ccnc(Cl)c3C#N)cc12 | CACTVS 3.385 | CNC(=O)[CH](C)NC1=CC(=O)Nc2ccc(Nc3ccnc(Cl)c3C#N)cc12 | OpenEye OEToolkits 2.0.7 | C[C@H](C(=O)NC)NC1=CC(=O)Nc2c1cc(cc2)Nc3ccnc(c3C#N)Cl |
|
Formula | C19 H17 Cl N6 O2 |
Name | (2R)-2-[[6-[(2-chloranyl-3-cyano-pyridin-4-yl)amino]-2-oxidanylidene-1H-quinolin-4-yl]amino]-N-methyl-propanamide; (2R)-2-[[6-[(2-Chloro-3-cyanopyridin-4-yl)amino]-2-oxo-1H-quinolin-4-yl]amino]-N-methylpropanamide; 142478375 |
ChEMBL | CHEMBL5080836 |
DrugBank | |
ZINC |
|
PDB chain | 7okj Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|