Structure of PDB 7kco Chain A Binding Site BS03 |
|
|
Ligand ID | WB7 |
InChI | InChI=1S/C27H29ClN2O4S2/c1-36(32,33)22-8-6-19(7-9-22)17-29-26(31)24-16-20-10-15-34-27(25(20)35-24)11-13-30(14-12-27)18-21-4-2-3-5-23(21)28/h2-9,16H,10-15,17-18H2,1H3,(H,29,31) |
InChIKey | FADIARAUFGUAAD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[S](=O)(=O)c1ccc(CNC(=O)c2sc3c(CCOC34CCN(CC4)Cc5ccccc5Cl)c2)cc1 | ACDLabs 12.01 | O=C(NCc1ccc(S(=O)(=O)C)cc1)c4sc5C2(CCN(CC2)Cc3ccccc3Cl)OCCc5c4 | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1ccc(cc1)CNC(=O)c2cc3c(s2)C4(CCN(CC4)Cc5ccccc5Cl)OCC3 |
|
Formula | C27 H29 Cl N2 O4 S2 |
Name | 1-[(2-chlorophenyl)methyl]-N-{[4-(methylsulfonyl)phenyl]methyl}-4',5'-dihydrospiro[piperidine-4,7'-thieno[2,3-c]pyran]-2'-carboxamide |
ChEMBL | CHEMBL5081557 |
DrugBank | |
ZINC |
|
PDB chain | 7kco Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|