Structure of PDB 7e1s Chain A Binding Site BS03 |
|
|
Ligand ID | 66S |
InChI | InChI=1S/C19H37N2O8PS/c1-4-5-6-7-8-9-16(23)31-13-12-20-15(22)10-11-21-18(25)17(24)19(2,3)14-29-30(26,27)28/h17,24H,4-14H2,1-3H3,(H,20,22)(H,21,25)(H2,26,27,28)/t17-/m0/s1 |
InChIKey | JIQRMRIKUIPMRV-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)O)O | ACDLabs 12.01 | P(=O)(O)(OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCC)O | CACTVS 3.385 | CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[CH](O)C(C)(C)CO[P](O)(O)=O | OpenEye OEToolkits 2.0.4 | CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)O)O | CACTVS 3.385 | CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO[P](O)(O)=O |
|
Formula | C19 H37 N2 O8 P S |
Name | S-[2-({N-[(2R)-2-hydroxy-3,3-dimethyl-4-(phosphonooxy)butanoyl]-beta-alanyl}amino)ethyl] octanethioate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000140535947
|
PDB chain | 7e1s Chain B Residue 101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|