Structure of PDB 6yzu Chain A Binding Site BS03 |
|
|
Ligand ID | Q4B |
InChI | InChI=1S/C7H12B9NO2S/c17-20(18,19)5-3-1-2-4-7-6-8-10-9(7)13(7)11(6,7)12(6,8)14(8,10)15(9,10,13)16(11,12,13)14/h1-5H2,(H2,17,18,19) |
InChIKey | GTLHEFZDKOVWKR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[S](=O)(=O)CCCCC[C+]123[B-]45[B-]67[B+]89[C@@]1%10[B]8%11%12[B]69%13[B]47%14[B]25%15[B]3%10%11[B]%12%13%14%15 | CACTVS 3.385 | N[S](=O)(=O)CCCCC[C+]123[B-]45[B-]67[B+]89[C]1%10[B]8%11%12[B]69%13[B]47%14[B]25%15[B]3%10%11[B]%12%13%14%15 | OpenEye OEToolkits 2.0.7 | B123B45B167B289B31B823B966B744B622C45C321CCCCCS(=O)(=O)N | OpenEye OEToolkits 2.0.7 | B123B45B167B289B31B823B966B744B622[C@@]45C321CCCCCS(=O)(=O)N |
|
Formula | C7 H12 B9 N O2 S |
Name | Carborane nido-pentyl-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6yzu Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|