Structure of PDB 6ti4 Chain A Binding Site BS03 |
|
|
Ligand ID | O3Z |
InChI | InChI=1S/C11H17N2O8P/c1-6-10(15)8(3-13-9(4-14)11(16)17)7(2-12-6)5-21-22(18,19)20/h2,9,13-15H,3-5H2,1H3,(H,16,17)(H2,18,19,20)/t9-/m1/s1 |
InChIKey | ODVKKQWXKRZJLG-SECBINFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN[C@H](CO)C(O)=O)c1O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(CO)C(=O)O)O | OpenEye OEToolkits 2.0.7 | Cc1c(c(c(cn1)COP(=O)(O)O)CN[C@H](CO)C(=O)O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN[CH](CO)C(O)=O)c1O |
|
Formula | C11 H17 N2 O8 P |
Name | (2~{R})-2-[[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]methylamino]-3-oxidanyl-propanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ti4 Chain C Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|