Structure of PDB 6r4d Chain A Binding Site BS03 |
|
|
Ligand ID | JRW |
InChI | InChI=1S/C19H26N2O2/c1-12(2)18-11-19(23,21(17(18)22)15-5-4-6-15)16-8-7-13(3)9-14(16)10-20-18/h7-9,12,15,20,23H,4-6,10-11H2,1-3H3/t18-,19-/m0/s1 |
InChIKey | HABACEYDTYGRSK-OALUTQOASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1ccc2c(c1)CNC3(CC2(N(C3=O)C4CCC4)O)C(C)C | CACTVS 3.385 | CC(C)[C@@]12C[C@@](O)(N(C3CCC3)C1=O)c4ccc(C)cc4CN2 | CACTVS 3.385 | CC(C)[C]12C[C](O)(N(C3CCC3)C1=O)c4ccc(C)cc4CN2 | OpenEye OEToolkits 2.0.7 | Cc1ccc2c(c1)CN[C@@]3(C[C@]2(N(C3=O)C4CCC4)O)C(C)C |
|
Formula | C19 H26 N2 O2 |
Name | (1~{S},10~{S})-12-cyclobutyl-5-methyl-1-oxidanyl-10-propan-2-yl-9,12-diazatricyclo[8.2.1.0^{2,7}]trideca-2(7),3,5-trien-11-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6r4d Chain A Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|