Structure of PDB 6ny7 Chain A Binding Site BS03 |
|
|
Ligand ID | L8J |
InChI | InChI=1S/C10H8Br2NO4P/c11-6-2-7(12)10-5(4-18(15,16)17)1-9(14)13-8(10)3-6/h1-3H,4H2,(H,13,14)(H2,15,16,17) |
InChIKey | YMPWKSWKTYLHON-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[P](O)(=O)CC1=CC(=O)Nc2cc(Br)cc(Br)c12 | OpenEye OEToolkits 2.0.7 | c1c(cc(c2c1NC(=O)C=C2CP(=O)(O)O)Br)Br | ACDLabs 12.01 | c1(cc(Br)c2c(c1)NC(C=C2CP(O)(O)=O)=O)Br |
|
Formula | C10 H8 Br2 N O4 P |
Name | [(5,7-dibromo-2-oxo-1,2-dihydroquinolin-4-yl)methyl]phosphonic acid |
ChEMBL | CHEMBL4550875 |
DrugBank | |
ZINC |
|
PDB chain | 6ny7 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|