Structure of PDB 6nvf Chain A Binding Site BS03 |
|
|
Ligand ID | L5A |
InChI | InChI=1S/C16H20O4/c17-15(18)9-12-6-4-11(5-7-12)8-13-2-1-3-14(13)10-16(19)20/h4-7,13-14H,1-3,8-10H2,(H,17,18)(H,19,20)/t13-,14-/m0/s1 |
InChIKey | QKXFMUHRVZWRPO-KBPBESRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C[C@@H]1CCC[C@H]1Cc2ccc(CC(O)=O)cc2 | OpenEye OEToolkits 2.0.7 | c1cc(ccc1C[C@@H]2CCC[C@H]2CC(=O)O)CC(=O)O | ACDLabs 12.01 | C1(C(CC(O)=O)CCC1)Cc2ccc(cc2)CC(O)=O | CACTVS 3.385 | OC(=O)C[CH]1CCC[CH]1Cc2ccc(CC(O)=O)cc2 | OpenEye OEToolkits 2.0.7 | c1cc(ccc1CC2CCCC2CC(=O)O)CC(=O)O |
|
Formula | C16 H20 O4 |
Name | (4-{[(1S,2S)-2-(carboxymethyl)cyclopentyl]methyl}phenyl)acetic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6nvf Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|