Structure of PDB 6jn6 Chain A Binding Site BS03 |
|
|
Ligand ID | BY0 |
InChI | InChI=1S/C14H18BNO4S/c1-9(8-21)14(17)16-13(15(18)19)6-10-7-20-12-5-3-2-4-11(10)12/h2-5,7,9,13,18-19,21H,6,8H2,1H3,(H,16,17)/t9-,13-/m1/s1 |
InChIKey | RHFFZKGRUWBIGC-NOZJJQNGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H](CS)C(=O)N[C@H](Cc1coc2ccccc12)B(O)O | OpenEye OEToolkits 2.0.6 | B([C@@H](Cc1coc2c1cccc2)NC(=O)[C@H](C)CS)(O)O | OpenEye OEToolkits 2.0.6 | B(C(Cc1coc2c1cccc2)NC(=O)C(C)CS)(O)O | CACTVS 3.385 | C[CH](CS)C(=O)N[CH](Cc1coc2ccccc12)B(O)O |
|
Formula | C14 H18 B N O4 S |
Name | [(1S)-2-(1-benzofuran-3-yl)-1-[[(2S)-2-methyl-3-sulfanyl-propanoyl]amino]ethyl]boronic acid |
ChEMBL | CHEMBL4460127 |
DrugBank | |
ZINC |
|
PDB chain | 6jn6 Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|