Structure of PDB 6h4t Chain A Binding Site BS03 |
|
|
Ligand ID | FOW |
InChI | InChI=1S/C25H26N6O/c32-24-20-6-11-26-23(22(20)27-17-28-24)31-16-18(15-29-31)7-12-30-13-9-25(10-14-30)8-5-19-3-1-2-4-21(19)25/h1-4,6,11,15-17H,5,7-10,12-14H2,(H,27,28,32) |
InChIKey | AVFIHINZEZRGBL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)CCC23CCN(CC3)CCc4cnn(c4)c5c6c(ccn5)C(=O)NC=N6 | CACTVS 3.385 | O=C1NC=Nc2c1ccnc2n3cc(CCN4CCC5(CC4)CCc6ccccc56)cn3 |
|
Formula | C25 H26 N6 O |
Name | 8-[4-(2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl)pyrazol-1-yl]-3~{H}-pyrido[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL4449500 |
DrugBank | |
ZINC |
|
PDB chain | 6h4t Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 6h4t C8-substituted pyrido[3,4-d]pyrimidin-4(3H)-ones: Studies towards the identification of potent, cell penetrant Jumonji C domain containing histone lysine demethylase 4 subfamily (KDM4) inhibitors, compound profiling in cell-based target engagement assays. |
Resolution | 2.38 Å |
Binding residue (original residue number in PDB) | Y132 D135 Y175 Y177 F185 H188 E190 K206 W208 K241 H276 D311 |
Binding residue (residue number reindexed from 1) | Y126 D129 Y161 Y163 F171 H174 E176 K192 W194 K227 H262 D297 |
Annotation score | 1 |
Binding affinity | MOAD: Ki=0.004uM PDBbind-CN: -logKd/Ki=7.00,IC50=0.100uM BindingDB: IC50=423nM,EC50=4700nM,Ki=4.0nM |
|
|
|
|