Structure of PDB 6giu Chain A Binding Site BS03 |
|
|
Ligand ID | L69 |
InChI | InChI=1S/C8H12O8P2/c1-8(17(10,11)12,18(13,14)15)16-7-4-2-6(9)3-5-7/h2-5,9H,1H3,(H2,10,11,12)(H2,13,14,15) |
InChIKey | JKOCAAWWDVHWKB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(Oc1ccc(cc1)O)(P(=O)(O)O)P(=O)(O)O | CACTVS 3.385 | CC(Oc1ccc(O)cc1)([P](O)(O)=O)[P](O)(O)=O |
|
Formula | C8 H12 O8 P2 |
Name | [1-(4-oxidanylphenoxy)-1-phosphono-ethyl]phosphonic acid; L-690330 |
ChEMBL | CHEMBL34819 |
DrugBank | |
ZINC | ZINC000001533832
|
PDB chain | 6giu Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|