Structure of PDB 6g07 Chain A Binding Site BS03 |
|
|
Ligand ID | EEZ |
InChI | InChI=1S/C23H23ClN2O4S/c1-3-31(28,29)20-11-9-17(10-12-20)13-22(27)26-19-14-21(24)23(25-15-19)30-16(2)18-7-5-4-6-8-18/h4-12,14-16H,3,13H2,1-2H3,(H,26,27)/t16-/m0/s1 |
InChIKey | VMHNMQCWPLURSW-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[S](=O)(=O)c1ccc(CC(=O)Nc2cnc(O[CH](C)c3ccccc3)c(Cl)c2)cc1 | OpenEye OEToolkits 2.0.6 | CCS(=O)(=O)c1ccc(cc1)CC(=O)Nc2cc(c(nc2)O[C@@H](C)c3ccccc3)Cl | CACTVS 3.385 | CC[S](=O)(=O)c1ccc(CC(=O)Nc2cnc(O[C@@H](C)c3ccccc3)c(Cl)c2)cc1 | OpenEye OEToolkits 2.0.6 | CCS(=O)(=O)c1ccc(cc1)CC(=O)Nc2cc(c(nc2)OC(C)c3ccccc3)Cl |
|
Formula | C23 H23 Cl N2 O4 S |
Name | ~{N}-[5-chloranyl-6-[(1~{S})-1-phenylethoxy]pyridin-3-yl]-2-(4-ethylsulfonylphenyl)ethanamide |
ChEMBL | CHEMBL4175305 |
DrugBank | |
ZINC |
|
PDB chain | 6g07 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|