Structure of PDB 6f5w Chain A Binding Site BS03 |
|
|
Ligand ID | KG1 |
InChI | InChI=1S/C9H14O5/c1-3-4-13-9-8(12)7(11)6(10)5(2)14-9/h4-12H,1H2,2H3/t5-,6+,7+,8-,9+/m0/s1 |
InChIKey | ZGNQHYGPHWSZCN-JTPBWFLFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1C(C(C(C(O1)OC=C=C)O)O)O | OpenEye OEToolkits 2.0.6 | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC=C=C)O)O)O | CACTVS 3.385 | C[CH]1O[CH](O[CH]=[C]=[CH2])[CH](O)[CH](O)[CH]1O | CACTVS 3.385 | C[C@@H]1O[C@@H](O[CH]=[C]=[CH2])[C@@H](O)[C@H](O)[C@@H]1O |
|
Formula | C9 H14 O5 |
Name | propadienyl 6-deoxy-alpha-L-galactopyranoside; propargyl-fucoside; propadienyl 6-deoxy-alpha-L-galactoside; propadienyl 6-deoxy-L-galactoside; propadienyl 6-deoxy-galactoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6f5w Chain A Residue 415
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|