Structure of PDB 6et4 Chain A Binding Site BS03 |
|
|
Ligand ID | SDV |
InChI | InChI=1S/C21H17FN4O2/c22-15-7-2-4-10-19(15)26-18-11-5-9-16(14(18)12-23-26)24-21(27)20-13-6-1-3-8-17(13)25-28-20/h1-4,6-8,10,12,16H,5,9,11H2,(H,24,27)/t16-/m1/s1 |
InChIKey | KVYFUACEMBMTLM-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(on2)C(=O)N[C@@H]3CCCc4c3cnn4c5ccccc5F | CACTVS 3.385 | Fc1ccccc1n2ncc3[CH](CCCc23)NC(=O)c4onc5ccccc45 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(on2)C(=O)NC3CCCc4c3cnn4c5ccccc5F | CACTVS 3.385 | Fc1ccccc1n2ncc3[C@@H](CCCc23)NC(=O)c4onc5ccccc45 |
|
Formula | C21 H17 F N4 O2 |
Name | N-[(4R)-1-(2-fluorophenyl)-4,5,6,7-tetrahydroindazol-4-yl]-2,1-benzoxazole-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6et4 Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|