Structure of PDB 6d1j Chain A Binding Site BS03 |
|
|
Ligand ID | 7SX |
InChI | InChI=1S/C12H14NO4P/c1-7-3-8(2)12-9(6-18(15,16)17)5-11(14)13-10(12)4-7/h3-5H,6H2,1-2H3,(H,13,14)(H2,15,16,17) |
InChIKey | HMRCSSLTJXSSFR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cc(C)c2C(=CC(=O)Nc2c1)C[P](O)(O)=O | ACDLabs 12.01 | Cc1cc2c(c(c1)C)C(CP(O)(O)=O)=CC(=O)N2 | OpenEye OEToolkits 2.0.6 | Cc1cc(c2c(c1)NC(=O)C=C2CP(=O)(O)O)C |
|
Formula | C12 H14 N O4 P |
Name | [(5,7-dimethyl-2-oxo-1,2-dihydroquinolin-4-yl)methyl]phosphonic acid |
ChEMBL | CHEMBL4576418 |
DrugBank | |
ZINC | ZINC000621478201
|
PDB chain | 6d1j Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|