Structure of PDB 6cie Chain A Binding Site BS03 |
|
|
Ligand ID | 7R2 |
InChI | InChI=1S/C19H26N4S/c1-3-22(2)11-12-23-10-4-6-15-14-16(8-9-17(15)23)21-19(20)18-7-5-13-24-18/h5,7-9,13-14H,3-4,6,10-12H2,1-2H3,(H2,20,21) |
InChIKey | GDMWZTBOBNMXTL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1(sccc1)/C(Nc3cc2CCCN(c2cc3)CCN(C)CC)=N | CACTVS 3.385 | CCN(C)CCN1CCCc2cc(NC(=N)c3sccc3)ccc12 | OpenEye OEToolkits 2.0.6 | CCN(C)CCN1CCCc2c1ccc(c2)NC(=N)c3cccs3 | OpenEye OEToolkits 2.0.6 | [H]/N=C(\c1cccs1)/Nc2ccc3c(c2)CCCN3CCN(C)CC |
|
Formula | C19 H26 N4 S |
Name | N-(1-{2-[ethyl(methyl)amino]ethyl}-1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboximidamide |
ChEMBL | CHEMBL2219913 |
DrugBank | |
ZINC | ZINC000095552482
|
PDB chain | 6cie Chain A Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|