Structure of PDB 5z53 Chain A Binding Site BS03 |
|
|
Ligand ID | 0HZ |
InChI | InChI=1S/C11H19N5O2/c12-11(13)14-5-1-3-7-10(18)16-6-2-4-8(16)9(17)15-7/h7-8H,1-6H2,(H,15,17)(H4,12,13,14)/p+1/t7-,8+/m0/s1 |
InChIKey | ZRJHYOXNWCMGMW-JGVFFNPUSA-O |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C1N2C(C(=O)NC1CCCNC(=[NH2+])/N)CCC2 | CACTVS 3.341 | NC(=[NH2+])NCCC[C@@H]1NC(=O)[C@H]2CCCN2C1=O | CACTVS 3.341 | NC(=[NH2+])NCCC[CH]1NC(=O)[CH]2CCCN2C1=O |
|
Formula | C11 H20 N5 O2 |
Name | amino({3-[(3S,8aS)-1,4-dioxooctahydropyrrolo[1,2-a]pyrazin-3-yl]propyl}amino)methaniminium; CI-4; [cyclo-(l-Arg-d-Pro)] |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5z53 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|