Structure of PDB 5xds Chain A Binding Site BS03 |
|
|
Ligand ID | 83O |
InChI | InChI=1S/C5H8N4O2/c6-3(5(10)11)1-4-7-2-8-9-4/h2-3H,1,6H2,(H,10,11)(H,7,8,9)/t3-/m0/s1 |
InChIKey | CAPORZWUTKSILW-VKHMYHEASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[C@@H](Cc1[nH]cnn1)C(O)=O | OpenEye OEToolkits 2.0.6 | c1[nH]c(nn1)C[C@@H](C(=O)O)N | OpenEye OEToolkits 2.0.6 | c1[nH]c(nn1)CC(C(=O)O)N | CACTVS 3.385 | N[CH](Cc1[nH]cnn1)C(O)=O |
|
Formula | C5 H8 N4 O2 |
Name | (2S)-2-azanyl-3-(4H-1,2,4-triazol-3-yl)propanoic acid |
ChEMBL | CHEMBL4284682 |
DrugBank | |
ZINC | ZINC000006119233
|
PDB chain | 5xds Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.2.1.19: imidazoleglycerol-phosphate dehydratase. |
|
|
|