Structure of PDB 5wlr Chain A Binding Site BS03 |
|
|
Ligand ID | 86B |
InChI | InChI=1S/C12H20N2O4S/c1-9(2)14-7-10(15)8-18-11-3-5-12(6-4-11)19(13,16)17/h3-6,9-10,14-15H,7-8H2,1-2H3,(H2,13,16,17)/t10-/m0/s1 |
InChIKey | AWVJYQXSBBLZMK-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1(S(=O)(=O)N)ccc(cc1)OCC(CNC(C)C)O | CACTVS 3.385 | CC(C)NC[CH](O)COc1ccc(cc1)[S](N)(=O)=O | OpenEye OEToolkits 2.0.6 | CC(C)NCC(COc1ccc(cc1)S(=O)(=O)N)O | OpenEye OEToolkits 2.0.6 | CC(C)NC[C@@H](COc1ccc(cc1)S(=O)(=O)N)O | CACTVS 3.385 | CC(C)NC[C@H](O)COc1ccc(cc1)[S](N)(=O)=O |
|
Formula | C12 H20 N2 O4 S |
Name | 4-{(2S)-2-hydroxy-3-[(propan-2-yl)amino]propoxy}benzene-1-sulfonamide; aryloxy-2-hydroxypropylammine sulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5wlr Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|