Structure of PDB 5ud4 Chain A Binding Site BS03 |
|
|
Ligand ID | P6T |
InChI | InChI=1S/C6H14O12P2/c7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16/h3,5-7,9-10H,1-2H2,(H2,11,12,13)(H2,14,15,16)/t3-,5+,6-/m1/s1 |
InChIKey | XPYBSIWDXQFNMH-PQLUHFTBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[C@H](CO[P](O)(O)=O)[C@H](O)[C@H](O)C(=O)CO[P](O)(O)=O | OpenEye OEToolkits 1.5.0 | C(C(C(C(C(=O)COP(=O)(O)O)O)O)O)OP(=O)(O)O | ACDLabs 10.04 | O=P(O)(O)OCC(=O)C(O)C(O)C(O)COP(=O)(O)O | OpenEye OEToolkits 1.5.0 | C([C@H]([C@@H]([C@@H](C(=O)COP(=O)(O)O)O)O)O)OP(=O)(O)O | CACTVS 3.341 | O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)C(=O)CO[P](O)(O)=O |
|
Formula | C6 H14 O12 P2 |
Name | 1,6-di-O-phosphono-D-tagatose |
ChEMBL | CHEMBL1235115 |
DrugBank | DB02512 |
ZINC | ZINC000004523255
|
PDB chain | 5ud4 Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.1.2.13: fructose-bisphosphate aldolase. |
|
|
|