Structure of PDB 5os4 Chain A Binding Site BS03 |
|
|
Ligand ID | A8H |
InChI | InChI=1S/C14H15NO2/c16-13-11-7-6-10(8-12(11)14(17)15-13)9-4-2-1-3-5-9/h1-5,10-12H,6-8H2,(H,15,16,17)/t10-,11-,12+/m0/s1 |
InChIKey | SHLALXCFPAKZHG-SDDRHHMPSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C2CCC3C(C2)C(=O)NC3=O | CACTVS 3.385 | O=C1NC(=O)[C@@H]2C[C@H](CC[C@H]12)c3ccccc3 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)[C@H]2CC[C@H]3[C@@H](C2)C(=O)NC3=O | CACTVS 3.385 | O=C1NC(=O)[CH]2C[CH](CC[CH]12)c3ccccc3 |
|
Formula | C14 H15 N O2 |
Name | (3~{a}~{R},5~{S},7~{a}~{S})-5-phenyl-3~{a},4,5,6,7,7~{a}-hexahydroisoindole-1,3-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5os4 Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|