Structure of PDB 5oi2 Chain A Binding Site BS03 |
|
|
Ligand ID | 9VN |
InChI | InChI=1S/C24H31NO3S/c1-15-18(20(22(26)27)28-23(2,3)4)19(16-7-11-24(5,6)12-8-16)21(29-15)17-9-13-25-14-10-17/h7,9-10,13-14,20H,8,11-12H2,1-6H3,(H,26,27)/t20-/m0/s1 |
InChIKey | AOGLTJVFULDNHV-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1sc(c2ccncc2)c(C3=CCC(C)(C)CC3)c1[C@H](OC(C)(C)C)C(O)=O | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(s1)c2ccncc2)C3=CCC(CC3)(C)C)[C@@H](C(=O)O)OC(C)(C)C | OpenEye OEToolkits 2.0.6 | Cc1c(c(c(s1)c2ccncc2)C3=CCC(CC3)(C)C)C(C(=O)O)OC(C)(C)C | CACTVS 3.385 | Cc1sc(c2ccncc2)c(C3=CCC(C)(C)CC3)c1[CH](OC(C)(C)C)C(O)=O |
|
Formula | C24 H31 N O3 S |
Name | (2~{S})-2-[4-(4,4-dimethylcyclohexen-1-yl)-2-methyl-5-pyridin-4-yl-thiophen-3-yl]-2-[(2-methylpropan-2-yl)oxy]ethanoic acid |
ChEMBL | CHEMBL5086864 |
DrugBank | |
ZINC |
|
PDB chain | 5oi2 Chain A Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|