Structure of PDB 5ngq Chain A Binding Site BS03 |
|
|
Ligand ID | ZDC |
InChI | InChI=1S/C8H14O6/c1-3-6(11)8(13)7(12)4(14-3)2-5(9)10/h3-4,6-8,11-13H,2H2,1H3,(H,9,10)/t3-,4-,6+,7+,8+/m0/s1 |
InChIKey | YTZUDUWVQZSKNN-OASCRQMUSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CC1OC(C(O)C(O)C1O)C | OpenEye OEToolkits 1.7.6 | CC1C(C(C(C(O1)CC(=O)O)O)O)O | CACTVS 3.370 | C[C@@H]1O[C@@H](CC(O)=O)[C@@H](O)[C@H](O)[C@@H]1O | CACTVS 3.370 | C[CH]1O[CH](CC(O)=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.7.6 | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)CC(=O)O)O)O)O |
|
Formula | C8 H14 O6 |
Name | 3,7-anhydro-2,8-dideoxy-L-glycero-D-gluco-octonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000166514822
|
PDB chain | 5ngq Chain G Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|