Structure of PDB 5jfr Chain A Binding Site BS03 |
|
|
Ligand ID | 6KP |
InChI | InChI=1S/C16H11FN6/c1-8-13(5-11-16(21-8)19-7-18-11)23-12-3-2-9(17)4-10(12)15-14(23)6-20-22-15/h2-7H,1H3,(H,20,22)(H,18,19,21) |
InChIKey | BGVWCIRYUNODHW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | Cc1c(cc2c(n1)[nH]cn2)n3c4ccc(cc4c5c3c[nH]n5)F | ACDLabs 12.01 | n1c(C)c(cc2c1ncn2)n4c3c(nnc3)c5cc(F)ccc45 | CACTVS 3.385 | Cc1nc2[nH]cnc2cc1n3c4c[nH]nc4c5cc(F)ccc35 |
|
Formula | C16 H11 F N6 |
Name | 7-fluoro-4-(5-methyl-3H-imidazo[4,5-b]pyridin-6-yl)-2,4-dihydropyrazolo[4,3-b]indole |
ChEMBL | CHEMBL3797399 |
DrugBank | |
ZINC | ZINC000210488947
|
PDB chain | 5jfr Chain A Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|