Structure of PDB 5i96 Chain A Binding Site BS03 |
|
|
Ligand ID | 69Q |
InChI | InChI=1S/C19H17F6N7O/c1-17(2,33)9-27-15-30-14(11-4-3-5-12(29-11)18(20,21)22)31-16(32-15)28-10-6-7-26-13(8-10)19(23,24)25/h3-8,33H,9H2,1-2H3,(H2,26,27,28,30,31,32) |
InChIKey | DYLUUSLLRIQKOE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c3(cccc(c1nc(NCC(O)(C)C)nc(n1)Nc2cc(ncc2)C(F)(F)F)n3)C(F)(F)F | OpenEye OEToolkits 2.0.4 | CC(C)(CNc1nc(nc(n1)Nc2ccnc(c2)C(F)(F)F)c3cccc(n3)C(F)(F)F)O | CACTVS 3.385 | CC(C)(O)CNc1nc(Nc2ccnc(c2)C(F)(F)F)nc(n1)c3cccc(n3)C(F)(F)F |
|
Formula | C19 H17 F6 N7 O |
Name | 2-methyl-1-[(4-[6-(trifluoromethyl)pyridin-2-yl]-6-{[2-(trifluoromethyl)pyridin-4-yl]amino}-1,3,5-triazin-2-yl)amino]propan-2-ol; Enasidenib; AG-221 |
ChEMBL | CHEMBL3989908 |
DrugBank | DB13874 |
ZINC | ZINC000222731806
|
PDB chain | 5i96 Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.42: isocitrate dehydrogenase (NADP(+)). |
|
|
|