Structure of PDB 5i5u Chain A Binding Site BS03 |
|
|
Ligand ID | 67Y |
InChI | InChI=1S/C12H15NO2/c14-8-12(15)13-11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11,14H,3,5,7-8H2,(H,13,15)/t11-/m1/s1 |
InChIKey | BBTOVZWCAMQWRJ-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | c1ccc2c(c1)CCC[C@H]2NC(=O)CO | OpenEye OEToolkits 2.0.4 | c1ccc2c(c1)CCCC2NC(=O)CO | CACTVS 3.385 | OCC(=O)N[CH]1CCCc2ccccc12 | CACTVS 3.385 | OCC(=O)N[C@@H]1CCCc2ccccc12 | ACDLabs 12.01 | C2(c1c(cccc1)CCC2)NC(CO)=O |
|
Formula | C12 H15 N O2 |
Name | 2-hydroxy-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000021952941
|
PDB chain | 5i5u Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K202 |
Catalytic site (residue number reindexed from 1) |
K200 |
Enzyme Commision number |
2.6.1.42: branched-chain-amino-acid transaminase. |
|
|
|