Structure of PDB 5hez Chain A Binding Site BS03 |
|
|
Ligand ID | 1M3 |
InChI | InChI=1S/C26H35N7O2S/c1-19-18-27-25(29-20-9-11-22(12-10-20)33-15-13-32(5)14-16-33)30-24(19)28-21-7-6-8-23(17-21)36(34,35)31-26(2,3)4/h6-12,17-18,31H,13-16H2,1-5H3,(H2,27,28,29,30) |
InChIKey | JVDOKQYTTYUYDV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1CCN(CC1)c2ccc(Nc3ncc(C)c(Nc4cccc(c4)[S](=O)(=O)NC(C)(C)C)n3)cc2 | OpenEye OEToolkits 1.7.6 | Cc1cnc(nc1Nc2cccc(c2)S(=O)(=O)NC(C)(C)C)Nc3ccc(cc3)N4CCN(CC4)C | ACDLabs 12.01 | O=S(=O)(NC(C)(C)C)c1cccc(c1)Nc2nc(ncc2C)Nc3ccc(cc3)N4CCN(C)CC4 |
|
Formula | C26 H35 N7 O2 S |
Name | N-tert-butyl-3-[(5-methyl-2-{[4-(4-methylpiperazin-1-yl)phenyl]amino}pyrimidin-4-yl)amino]benzenesulfonamide |
ChEMBL | CHEMBL1995703 |
DrugBank | |
ZINC | ZINC000063539888
|
PDB chain | 5hez Chain A Residue 1204
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|