Structure of PDB 5hc8 Chain A Binding Site BS03 |
|
|
Ligand ID | ISY |
InChI | InChI=1S/C5H12O6P2S/c1-5(2)3-4-14-13(9,10)11-12(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8) |
InChIKey | YLTQZUVQWVAPNP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(=C)CCSP(=O)(O)OP(=O)(O)O | OpenEye OEToolkits 1.7.0 | CC(=C)CCS[P@@](=O)(O)OP(=O)(O)O | ACDLabs 12.01 | O=P(O)(OP(=O)(O)SCCC(=C)\C)O | CACTVS 3.370 | CC(=C)CCS[P](O)(=O)O[P](O)(O)=O |
|
Formula | C5 H12 O6 P2 S |
Name | 3-methylbut-3-enylsulfanyl(phosphonooxy)phosphinic acid; Isopentyl S-Thiolodiphosphate |
ChEMBL | CHEMBL448120 |
DrugBank | |
ZINC |
|
PDB chain | 5hc8 Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|