Structure of PDB 5fes Chain A Binding Site BS03 |
|
|
Ligand ID | 9SE |
InChI | InChI=1S/C6H9NO4Se/c1-6(5(10)11)7-3(2-12-6)4(8)9/h3,7H,2H2,1H3,(H,8,9)(H,10,11)/t3-,6+/m0/s1 |
InChIKey | YQSKWMPEENRPTH-BBIVZNJYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | C[C@]1(N[C@@H](C[Se]1)C(=O)O)C(=O)O | OpenEye OEToolkits 2.0.4 | CC1(NC(C[Se]1)C(=O)O)C(=O)O | CACTVS 3.385 | C[C]1(N[CH](C[Se]1)C(O)=O)C(O)=O | CACTVS 3.385 | C[C@]1(N[C@@H](C[Se]1)C(O)=O)C(O)=O |
|
Formula | C6 H9 N O4 Se |
Name | (2~{R},4~{R})-2-methyl-1,3-selenazolidine-2,4-dicarboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5fes Chain A Residue 409
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|